C12H18F2IN3O — CID 111752212
2-[2-(2,4-difluorophenoxy)ethyl]-1-propan-2-ylguanidine;hydroiodide (PubChem CID 111752212) has the molecular formula C12H18F2IN3O and a molecular weight of 385.20 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenoxy)ethyl]-1-propan-2-ylguanidine;hydroiodide.
| Compound Name | 2-[2-(2,4-difluorophenoxy)ethyl]-1-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111752212 |
| Molecular Formula | C12H18F2IN3O |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-[2-(2,4-difluorophenoxy)ethyl]-1-propan-2-ylguanidine;hydroiodide |
| SMILES | CC(C)N/C(N)=N/CCOc1ccc(F)cc1F.I |
| InChI | InChI=1S/C12H17F2N3O.HI/c1-8(2)17-12(15)16-5-6-18-11-4-3-9(13)7-10(11)14;/h3-4,7-8H,5-6H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | UHZCLUHYFRFROW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|