C14H21F2N5O2 — CID 75308392
1-[amino-[3-(2,4-difluorophenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine (PubChem CID 75308392) has the molecular formula C14H21F2N5O2 and a molecular weight of 329.35 g/mol. Its IUPAC name is 1-[amino-[3-(2,4-difluorophenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine.
| Compound Name | 1-[amino-[3-(2,4-difluorophenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 75308392 |
| Molecular Formula | C14H21F2N5O2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[amino-[3-(2,4-difluorophenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine |
| SMILES | CC(C)/N=C(\N)N=C(N)NOCCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C14H21F2N5O2/c1-9(2)19-13(17)20-14(18)21-23-7-3-6-22-12-5-4-10(15)8-11(12)16/h4-5,8-9H,3,6-7H2,1-2H3,(H5,17,18,19,20,21) |
| InChIKey | OHOXORNYWOXFKI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|