C15H21F2N5O4 — CID 85087970
1-[amino-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]propoxyamino]methylidene]-2-propan-2-ylguanidine (PubChem CID 85087970) has the molecular formula C15H21F2N5O4 and a molecular weight of 373.36 g/mol. Its IUPAC name is 1-[amino-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]propoxyamino]methylidene]-2-propan-2-ylguanidine.
| Compound Name | 1-[amino-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]propoxyamino]methylidene]-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 85087970 |
| Molecular Formula | C15H21F2N5O4 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[amino-[3-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]propoxyamino]methylidene]-2-propan-2-ylguanidine |
| SMILES | CC(C)/N=C(\N)N=C(N)NOCCCOc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C15H21F2N5O4/c1-9(2)20-13(18)21-14(19)22-24-7-3-6-23-10-4-5-11-12(8-10)26-15(16,17)25-11/h4-5,8-9H,3,6-7H2,1-2H3,(H5,18,19,20,21,22) |
| InChIKey | HTMQJEBJYXRNON-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|