C12H15F2N3O2 — CID 55068216
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(2-methylpropyl)guanidine (PubChem CID 55068216) has the molecular formula C12H15F2N3O2 and a molecular weight of 271.27 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(2-methylpropyl)guanidine.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 55068216 |
| Molecular Formula | C12H15F2N3O2 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(2-methylpropyl)guanidine |
| SMILES | CC(C)C/N=C(\N)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H15F2N3O2/c1-7(2)6-16-11(15)17-8-3-4-9-10(5-8)19-12(13,14)18-9/h3-5,7H,6H2,1-2H3,(H3,15,16,17) |
| InChIKey | HUAVJVWXCVQCCS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|