C10H10F2N2O2S — CID 47506592
3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1,1-dimethylthiourea (PubChem CID 47506592) has the molecular formula C10H10F2N2O2S and a molecular weight of 260.26 g/mol. Its IUPAC name is 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1,1-dimethylthiourea.
| Compound Name | 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 47506592 |
| Molecular Formula | C10H10F2N2O2S |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C10H10F2N2O2S/c1-14(2)9(17)13-6-3-4-7-8(5-6)16-10(11,12)15-7/h3-5H,1-2H3,(H,13,17) |
| InChIKey | XEIWZFMASQSPSG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|