C14H20F2N2O2S2 — CID 14457255
N,N-diethylethanamine;(2,2-difluoro-1,3-benzodioxol-5-yl)carbamodithioic acid (PubChem CID 14457255) has the molecular formula C14H20F2N2O2S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is N,N-diethylethanamine;(2,2-difluoro-1,3-benzodioxol-5-yl)carbamodithioic acid.
| Compound Name | N,N-diethylethanamine;(2,2-difluoro-1,3-benzodioxol-5-yl)carbamodithioic acid |
|---|---|
| PubChem CID | 14457255 |
| Molecular Formula | C14H20F2N2O2S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N,N-diethylethanamine;(2,2-difluoro-1,3-benzodioxol-5-yl)carbamodithioic acid |
| SMILES | CCN(CC)CC.FC1(F)Oc2ccc(NC(=S)S)cc2O1 |
| InChI | InChI=1S/C8H5F2NO2S2.C6H15N/c9-8(10)12-5-2-1-4(11-7(14)15)3-6(5)13-8;1-4-7(5-2)6-3/h1-3H,(H2,11,14,15);4-6H2,1-3H3 |
| InChIKey | MLDGLZCZFYQGOS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|