C12H14F2N2O3S — CID 115573724
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(3-methoxypropyl)thiourea (PubChem CID 115573724) has the molecular formula C12H14F2N2O3S and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 115573724 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H14F2N2O3S/c1-17-6-2-5-15-11(20)16-8-3-4-9-10(7-8)19-12(13,14)18-9/h3-4,7H,2,5-6H2,1H3,(H2,15,16,20) |
| InChIKey | MRCNVBYDRCZGSV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|