C13H16F2N2O4 — CID 60673317
2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(3-methoxypropyl)acetamide (PubChem CID 60673317) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 60673317 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CNc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C13H16F2N2O4/c1-19-6-2-5-16-12(18)8-17-9-3-4-10-11(7-9)21-13(14,15)20-10/h3-4,7,17H,2,5-6,8H2,1H3,(H,16,18) |
| InChIKey | DEDJLOYYJHFGBN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|