C16H13ClF2N2O4 — CID 18096944
N-(3-chloro-4-methoxyphenyl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]acetamide (PubChem CID 18096944) has the molecular formula C16H13ClF2N2O4 and a molecular weight of 370.74 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]acetamide |
|---|---|
| PubChem CID | 18096944 |
| Molecular Formula | C16H13ClF2N2O4 |
| Molecular Weight | 370.74 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]acetamide |
| SMILES | COc1ccc(NC(=O)CNc2ccc3c(c2)OC(F)(F)O3)cc1Cl |
| InChI | InChI=1S/C16H13ClF2N2O4/c1-23-12-4-3-10(6-11(12)17)21-15(22)8-20-9-2-5-13-14(7-9)25-16(18,19)24-13/h2-7,20H,8H2,1H3,(H,21,22) |
| InChIKey | YFECEBDZPPHHPB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|