C11H14F2N2OS — CID 17272351
1-(3,5-difluorophenyl)-3-(3-methoxypropyl)thiourea (PubChem CID 17272351) has the molecular formula C11H14F2N2OS and a molecular weight of 260.31 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-(3,5-difluorophenyl)-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 17272351 |
| Molecular Formula | C11H14F2N2OS |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H14F2N2OS/c1-16-4-2-3-14-11(17)15-10-6-8(12)5-9(13)7-10/h5-7H,2-4H2,1H3,(H2,14,15,17) |
| InChIKey | SIDIJQBSLFSGDY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|