C17H16F2N2O3S — CID 71885981
1-benzyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(2-hydroxyethyl)thiourea (PubChem CID 71885981) has the molecular formula C17H16F2N2O3S and a molecular weight of 366.39 g/mol. Its IUPAC name is 1-benzyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(2-hydroxyethyl)thiourea.
| Compound Name | 1-benzyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 71885981 |
| Molecular Formula | C17H16F2N2O3S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 1-benzyl-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-(2-hydroxyethyl)thiourea |
| SMILES | OCCN(Cc1ccccc1)C(=S)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C17H16F2N2O3S/c18-17(19)23-14-7-6-13(10-15(14)24-17)20-16(25)21(8-9-22)11-12-4-2-1-3-5-12/h1-7,10,22H,8-9,11H2,(H,20,25) |
| InChIKey | HLIURUFTAHSPCV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|