C20H26N2OS — CID 5020523
1-benzyl-3-(2,6-diethylphenyl)-1-(2-hydroxyethyl)thiourea (PubChem CID 5020523) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 1-benzyl-3-(2,6-diethylphenyl)-1-(2-hydroxyethyl)thiourea.
| Compound Name | 1-benzyl-3-(2,6-diethylphenyl)-1-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 5020523 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-benzyl-3-(2,6-diethylphenyl)-1-(2-hydroxyethyl)thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2OS/c1-3-17-11-8-12-18(4-2)19(17)21-20(24)22(13-14-23)15-16-9-6-5-7-10-16/h5-12,23H,3-4,13-15H2,1-2H3,(H,21,24) |
| InChIKey | KHWUCBBBOLWMQB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|