C13H12F2N2O3S — CID 80593446
1-carbamothioyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclobutane-1-carboxamide (PubChem CID 80593446) has the molecular formula C13H12F2N2O3S and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80593446 |
| Molecular Formula | C13H12F2N2O3S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-carbamothioyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclobutane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2ccc3c(c2)OC(F)(F)O3)CCC1 |
| InChI | InChI=1S/C13H12F2N2O3S/c14-13(15)19-8-3-2-7(6-9(8)20-13)17-11(18)12(10(16)21)4-1-5-12/h2-3,6H,1,4-5H2,(H2,16,21)(H,17,18) |
| InChIKey | PXTFCKZTXDEFKV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|