C12H18BrN3 — CID 63334509
1-(3-bromo-4-methylphenyl)-2-(2-methylpropyl)guanidine (PubChem CID 63334509) has the molecular formula C12H18BrN3 and a molecular weight of 284.20 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-2-(2-methylpropyl)guanidine.
| Compound Name | 1-(3-bromo-4-methylphenyl)-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 63334509 |
| Molecular Formula | C12H18BrN3 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-2-(2-methylpropyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CC(C)C)cc1Br |
| InChI | InChI=1S/C12H18BrN3/c1-8(2)7-15-12(14)16-10-5-4-9(3)11(13)6-10/h4-6,8H,7H2,1-3H3,(H3,14,15,16) |
| InChIKey | BVXPYOZKIWHCPM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|