About 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine
1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine (PubChem CID 107579098) has the molecular formula C13H20BrN3
and a molecular weight of 298.23 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine.
Molecular Properties
| Compound Name | 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine |
| PubChem CID | 107579098 |
| Molecular Formula | C13H20BrN3 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine |
| SMILES | Cc1cc(N/C(N)=N/CC(C)C)cc(C)c1Br |
| InChI | InChI=1S/C13H20BrN3/c1-8(2)7-16-13(15)17-11-5-9(3)12(14)10(4)6-11/h5-6,8H,7H2,1-4H3,(H3,15,16,17) |
| InChIKey | IYHRCUYBKBUPKC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine?
The IUPAC name of 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine (CID 107579098) is 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine.
What is the SMILES notation for 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine?
The canonical SMILES for 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine is Cc1cc(N/C(N)=N/CC(C)C)cc(C)c1Br.
What is the InChIKey of 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine?
The InChIKey is IYHRCUYBKBUPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20BrN3/c1-8(2)7-16-13(15)17-11-5-9(3)12(14)10(4)6-11/h5-6,8H,7H2,1-4H3,(H3,15,16,17).
What are the key properties of 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine?
1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine has a molecular weight of 298.23 g/mol, XLogP of 3.45, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-3,5-dimethylphenyl)-2-(2-methylpropyl)guanidine is sourced from PubChem (CID 107579098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).