C9H11BrN2S — CID 50880536
(4-bromo-3,5-dimethylphenyl)thiourea (PubChem CID 50880536) has the molecular formula C9H11BrN2S and a molecular weight of 259.17 g/mol. Its IUPAC name is (4-bromo-3,5-dimethylphenyl)thiourea.
| Compound Name | (4-bromo-3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 50880536 |
| Molecular Formula | C9H11BrN2S |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | (4-bromo-3,5-dimethylphenyl)thiourea |
| SMILES | Cc1cc(NC(N)=S)cc(C)c1Br |
| InChI | InChI=1S/C9H11BrN2S/c1-5-3-7(12-9(11)13)4-6(2)8(5)10/h3-4H,1-2H3,(H3,11,12,13) |
| InChIKey | YXZLXZIDXBIPGX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|