C15H14Br2N2S — CID 107574743
5-bromo-2-(4-bromo-3,5-dimethylanilino)benzenecarbothioamide (PubChem CID 107574743) has the molecular formula C15H14Br2N2S and a molecular weight of 414.17 g/mol. Its IUPAC name is 5-bromo-2-(4-bromo-3,5-dimethylanilino)benzenecarbothioamide.
| Compound Name | 5-bromo-2-(4-bromo-3,5-dimethylanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107574743 |
| Molecular Formula | C15H14Br2N2S |
| Molecular Weight | 414.17 g/mol |
| Exact Mass | 411.92 |
| IUPAC Name | 5-bromo-2-(4-bromo-3,5-dimethylanilino)benzenecarbothioamide |
| SMILES | Cc1cc(Nc2ccc(Br)cc2C(N)=S)cc(C)c1Br |
| InChI | InChI=1S/C15H14Br2N2S/c1-8-5-11(6-9(2)14(8)17)19-13-4-3-10(16)7-12(13)15(18)20/h3-7,19H,1-2H3,(H2,18,20) |
| InChIKey | BJGSUWMHLYFMHV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.17 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|