C10H9BrN4S2 — CID 114892111
5-bromo-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzenecarbothioamide (PubChem CID 114892111) has the molecular formula C10H9BrN4S2 and a molecular weight of 329.25 g/mol. Its IUPAC name is 5-bromo-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114892111 |
| Molecular Formula | C10H9BrN4S2 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 5-bromo-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzenecarbothioamide |
| SMILES | Cc1nsc(Nc2ccc(Br)cc2C(N)=S)n1 |
| InChI | InChI=1S/C10H9BrN4S2/c1-5-13-10(17-15-5)14-8-3-2-6(11)4-7(8)9(12)16/h2-4H,1H3,(H2,12,16)(H,13,14,15) |
| InChIKey | VXZDJBAZARXCLO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|