C10H8BrFN4S2 — CID 107535424
2-bromo-3-fluoro-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzenecarbothioamide (PubChem CID 107535424) has the molecular formula C10H8BrFN4S2 and a molecular weight of 347.24 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107535424 |
| Molecular Formula | C10H8BrFN4S2 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | 2-bromo-3-fluoro-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzenecarbothioamide |
| SMILES | Cc1nsc(Nc2ccc(C(N)=S)c(Br)c2F)n1 |
| InChI | InChI=1S/C10H8BrFN4S2/c1-4-14-10(18-16-4)15-6-3-2-5(9(13)17)7(11)8(6)12/h2-3H,1H3,(H2,13,17)(H,14,15,16) |
| InChIKey | BHTUSJUWIWCYCN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|