C15H14BrFN2S — CID 107534614
2-bromo-4-(3,4-dimethylanilino)-3-fluorobenzenecarbothioamide (PubChem CID 107534614) has the molecular formula C15H14BrFN2S and a molecular weight of 353.26 g/mol. Its IUPAC name is 2-bromo-4-(3,4-dimethylanilino)-3-fluorobenzenecarbothioamide.
| Compound Name | 2-bromo-4-(3,4-dimethylanilino)-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107534614 |
| Molecular Formula | C15H14BrFN2S |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 2-bromo-4-(3,4-dimethylanilino)-3-fluorobenzenecarbothioamide |
| SMILES | Cc1ccc(Nc2ccc(C(N)=S)c(Br)c2F)cc1C |
| InChI | InChI=1S/C15H14BrFN2S/c1-8-3-4-10(7-9(8)2)19-12-6-5-11(15(18)20)13(16)14(12)17/h3-7,19H,1-2H3,(H2,18,20) |
| InChIKey | UYSZFVWFNAXYPZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|