C12H12BrFN4OS — CID 106418135
2-bromo-3-fluoro-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]benzenecarbothioamide (PubChem CID 106418135) has the molecular formula C12H12BrFN4OS and a molecular weight of 359.22 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 106418135 |
| Molecular Formula | C12H12BrFN4OS |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 2-bromo-3-fluoro-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]benzenecarbothioamide |
| SMILES | Cc1noc(CCNc2ccc(C(N)=S)c(Br)c2F)n1 |
| InChI | InChI=1S/C12H12BrFN4OS/c1-6-17-9(19-18-6)4-5-16-8-3-2-7(12(15)20)10(13)11(8)14/h2-3,16H,4-5H2,1H3,(H2,15,20) |
| InChIKey | XSABCDGNKJDOGW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|