C10H13BrN2O — CID 107574130
2-amino-N-(4-bromo-3,5-dimethylphenyl)acetamide (PubChem CID 107574130) has the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. Its IUPAC name is 2-amino-N-(4-bromo-3,5-dimethylphenyl)acetamide.
| Compound Name | 2-amino-N-(4-bromo-3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 107574130 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-amino-N-(4-bromo-3,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CN)cc(C)c1Br |
| InChI | InChI=1S/C10H13BrN2O/c1-6-3-8(13-9(14)5-12)4-7(2)10(6)11/h3-4H,5,12H2,1-2H3,(H,13,14) |
| InChIKey | HQVRIVBFPMUXQV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |