C14H20BrNO — CID 107574880
N-(4-bromo-3,5-dimethylphenyl)-3,3-dimethylbutanamide (PubChem CID 107574880) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-3,3-dimethylbutanamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 107574880 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-3,3-dimethylbutanamide |
| SMILES | Cc1cc(NC(=O)CC(C)(C)C)cc(C)c1Br |
| InChI | InChI=1S/C14H20BrNO/c1-9-6-11(7-10(2)13(9)15)16-12(17)8-14(3,4)5/h6-7H,8H2,1-5H3,(H,16,17) |
| InChIKey | OMLWRZWMGQYLHA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |