C14H21ClF3N5O2 — CID 75308366
1-[amino-[3-(2,3,5-trifluorophenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine;hydrochloride (PubChem CID 75308366) has the molecular formula C14H21ClF3N5O2 and a molecular weight of 383.80 g/mol. Its IUPAC name is 1-[amino-[3-(2,3,5-trifluorophenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine;hydrochloride.
| Compound Name | 1-[amino-[3-(2,3,5-trifluorophenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine;hydrochloride |
|---|---|
| PubChem CID | 75308366 |
| Molecular Formula | C14H21ClF3N5O2 |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-[amino-[3-(2,3,5-trifluorophenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine;hydrochloride |
| SMILES | CC(C)/N=C(\N)N=C(N)NOCCCOc1cc(F)cc(F)c1F.Cl |
| InChI | InChI=1S/C14H20F3N5O2.ClH/c1-8(2)20-13(18)21-14(19)22-24-5-3-4-23-11-7-9(15)6-10(16)12(11)17;/h6-8H,3-5H2,1-2H3,(H5,18,19,20,21,22);1H |
| InChIKey | JBIBONMLQUTWGP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|