C16H27N5O2 — CID 10958222
(1E)-1-[amino-[3-(2,4-dimethylphenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine (PubChem CID 10958222) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is (1E)-1-[amino-[3-(2,4-dimethylphenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine.
| Compound Name | (1E)-1-[amino-[3-(2,4-dimethylphenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 10958222 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | (1E)-1-[amino-[3-(2,4-dimethylphenoxy)propoxyamino]methylidene]-2-propan-2-ylguanidine |
| SMILES | Cc1ccc(OCCCON/C(N)=N/C(N)=N/C(C)C)c(C)c1 |
| InChI | InChI=1S/C16H27N5O2/c1-11(2)19-15(17)20-16(18)21-23-9-5-8-22-14-7-6-12(3)10-13(14)4/h6-7,10-11H,5,8-9H2,1-4H3,(H5,17,18,19,20,21) |
| InChIKey | ITPRNXXQNAMATA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|