C17H27N3O3 — CID 36748896
(2R)-2-(carbamoylamino)-N-[2-(2,4-dimethylphenoxy)ethyl]-4-methylpentanamide (PubChem CID 36748896) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2R)-2-(carbamoylamino)-N-[2-(2,4-dimethylphenoxy)ethyl]-4-methylpentanamide.
| Compound Name | (2R)-2-(carbamoylamino)-N-[2-(2,4-dimethylphenoxy)ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 36748896 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (2R)-2-(carbamoylamino)-N-[2-(2,4-dimethylphenoxy)ethyl]-4-methylpentanamide |
| SMILES | Cc1ccc(OCCNC(=O)[C@@H](CC(C)C)NC(N)=O)c(C)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-11(2)9-14(20-17(18)22)16(21)19-7-8-23-15-6-5-12(3)10-13(15)4/h5-6,10-11,14H,7-9H2,1-4H3,(H,19,21)(H3,18,20,22)/t14-/m1/s1 |
| InChIKey | YVBZWPXKWNCSIN-CQSZACIVSA-N |
| XLogP | 1.88 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|