C17H26N2O4 — CID 2537471
2-(2,5-dimethylphenoxy)ethyl (2S,3S)-2-(carbamoylamino)-3-methylpentanoate (PubChem CID 2537471) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)ethyl (2S,3S)-2-(carbamoylamino)-3-methylpentanoate.
| Compound Name | 2-(2,5-dimethylphenoxy)ethyl (2S,3S)-2-(carbamoylamino)-3-methylpentanoate |
|---|---|
| PubChem CID | 2537471 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)ethyl (2S,3S)-2-(carbamoylamino)-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(N)=O)C(=O)OCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C17H26N2O4/c1-5-12(3)15(19-17(18)21)16(20)23-9-8-22-14-10-11(2)6-7-13(14)4/h6-7,10,12,15H,5,8-9H2,1-4H3,(H3,18,19,21)/t12-,15-/m0/s1 |
| InChIKey | DQHYTJDEKNNIJN-WFASDCNBSA-N |
| XLogP | 2.31 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|