C17H27NO3 — CID 103771125
3-(2,4-dimethylphenoxy)-N-(2-hydroxy-4-methylpentyl)propanamide (PubChem CID 103771125) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-(2,4-dimethylphenoxy)-N-(2-hydroxy-4-methylpentyl)propanamide.
| Compound Name | 3-(2,4-dimethylphenoxy)-N-(2-hydroxy-4-methylpentyl)propanamide |
|---|---|
| PubChem CID | 103771125 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 3-(2,4-dimethylphenoxy)-N-(2-hydroxy-4-methylpentyl)propanamide |
| SMILES | Cc1ccc(OCCC(=O)NCC(O)CC(C)C)c(C)c1 |
| InChI | InChI=1S/C17H27NO3/c1-12(2)9-15(19)11-18-17(20)7-8-21-16-6-5-13(3)10-14(16)4/h5-6,10,12,15,19H,7-9,11H2,1-4H3,(H,18,20) |
| InChIKey | SWVSISVVXOYCCS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |