C14H22OS — CID 30842801
2,4-dimethyl-1-(3-propan-2-ylsulfanylpropoxy)benzene (PubChem CID 30842801) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is 2,4-dimethyl-1-(3-propan-2-ylsulfanylpropoxy)benzene.
| Compound Name | 2,4-dimethyl-1-(3-propan-2-ylsulfanylpropoxy)benzene |
|---|---|
| PubChem CID | 30842801 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2,4-dimethyl-1-(3-propan-2-ylsulfanylpropoxy)benzene |
| SMILES | Cc1ccc(OCCCSC(C)C)c(C)c1 |
| InChI | InChI=1S/C14H22OS/c1-11(2)16-9-5-8-15-14-7-6-12(3)10-13(14)4/h6-7,10-11H,5,8-9H2,1-4H3 |
| InChIKey | LRUTWZFXNJYCLS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|