C17H29NO — CID 106800672
6-(2,4-dimethylphenoxy)-N-propylhexan-3-amine (PubChem CID 106800672) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 6-(2,4-dimethylphenoxy)-N-propylhexan-3-amine.
| Compound Name | 6-(2,4-dimethylphenoxy)-N-propylhexan-3-amine |
|---|---|
| PubChem CID | 106800672 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 6-(2,4-dimethylphenoxy)-N-propylhexan-3-amine |
| SMILES | CCCNC(CC)CCCOc1ccc(C)cc1C |
| InChI | InChI=1S/C17H29NO/c1-5-11-18-16(6-2)8-7-12-19-17-10-9-14(3)13-15(17)4/h9-10,13,16,18H,5-8,11-12H2,1-4H3 |
| InChIKey | YVMDJZJXCSOGTA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|