C12H17BrO — CID 141270255
1-(3-bromobutoxy)-2,4-dimethylbenzene (PubChem CID 141270255) has the molecular formula C12H17BrO and a molecular weight of 257.17 g/mol. Its IUPAC name is 1-(3-bromobutoxy)-2,4-dimethylbenzene.
| Compound Name | 1-(3-bromobutoxy)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 141270255 |
| Molecular Formula | C12H17BrO |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1-(3-bromobutoxy)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(OCCC(C)Br)c(C)c1 |
| InChI | InChI=1S/C12H17BrO/c1-9-4-5-12(10(2)8-9)14-7-6-11(3)13/h4-5,8,11H,6-7H2,1-3H3 |
| InChIKey | IIDVGDKNRISTAB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|