C15H23F2NO2 — CID 118251939
1-[3,4-difluoro-5-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine (PubChem CID 118251939) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is 1-[3,4-difluoro-5-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine.
| Compound Name | 1-[3,4-difluoro-5-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 118251939 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-[3,4-difluoro-5-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine |
| SMILES | COCCCOc1cc(CC(N)C(C)C)cc(F)c1F |
| InChI | InChI=1S/C15H23F2NO2/c1-10(2)13(18)8-11-7-12(16)15(17)14(9-11)20-6-4-5-19-3/h7,9-10,13H,4-6,8,18H2,1-3H3 |
| InChIKey | NAUFRKPVOQSIJF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|