C15H24FNO2 — CID 125466344
(2S)-1-[4-fluoro-3-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine (PubChem CID 125466344) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is (2S)-1-[4-fluoro-3-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine.
| Compound Name | (2S)-1-[4-fluoro-3-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 125466344 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | (2S)-1-[4-fluoro-3-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine |
| SMILES | COCCCOc1cc(C[C@H](N)C(C)C)ccc1F |
| InChI | InChI=1S/C15H24FNO2/c1-11(2)14(17)9-12-5-6-13(16)15(10-12)19-8-4-7-18-3/h5-6,10-11,14H,4,7-9,17H2,1-3H3/t14-/m0/s1 |
| InChIKey | MCYUMJMXPFOISC-AWEZNQCLSA-N |
| XLogP | 2.77 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|