C20H32FNO6 — CID 69172594
5-amino-6-[[4-fluoro-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanoic acid (PubChem CID 69172594) has the molecular formula C20H32FNO6 and a molecular weight of 401.48 g/mol. Its IUPAC name is 5-amino-6-[[4-fluoro-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanoic acid.
| Compound Name | 5-amino-6-[[4-fluoro-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanoic acid |
|---|---|
| PubChem CID | 69172594 |
| Molecular Formula | C20H32FNO6 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 5-amino-6-[[4-fluoro-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanoic acid |
| SMILES | COCCCOc1cc(COCC(N)C(O)CC(C(=O)O)C(C)C)ccc1F |
| InChI | InChI=1S/C20H32FNO6/c1-13(2)15(20(24)25)10-18(23)17(22)12-27-11-14-5-6-16(21)19(9-14)28-8-4-7-26-3/h5-6,9,13,15,17-18,23H,4,7-8,10-12,22H2,1-3H3,(H,24,25) |
| InChIKey | GAUGBIHPMBHDEF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|