C26H37FN2O5 — CID 71019492
(2S,4S,5S)-5-amino-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanamide (PubChem CID 71019492) has the molecular formula C26H37FN2O5 and a molecular weight of 476.59 g/mol. Its IUPAC name is (2S,4S,5S)-5-amino-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanamide.
| Compound Name | (2S,4S,5S)-5-amino-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 71019492 |
| Molecular Formula | C26H37FN2O5 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | (2S,4S,5S)-5-amino-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanamide |
| SMILES | COCCCOc1cc(COC[C@H](N)[C@@H](O)C[C@H](C(N)=O)C(C)C)ccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H37FN2O5/c1-17(2)22(26(29)31)14-24(30)23(28)16-33-15-18-5-10-21(19-6-8-20(27)9-7-19)25(13-18)34-12-4-11-32-3/h5-10,13,17,22-24,30H,4,11-12,14-16,28H2,1-3H3,(H2,29,31)/t22-,23-,24-/m0/s1 |
| InChIKey | QRBIRCWRNLBUGM-HJOGWXRNSA-N |
| XLogP | 3.26 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|