C26H33FO6 — CID 69172068
5-[2-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-1-hydroxyethyl]-3-propan-2-yloxolan-2-one (PubChem CID 69172068) has the molecular formula C26H33FO6 and a molecular weight of 460.54 g/mol. Its IUPAC name is 5-[2-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-1-hydroxyethyl]-3-propan-2-yloxolan-2-one.
| Compound Name | 5-[2-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-1-hydroxyethyl]-3-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 69172068 |
| Molecular Formula | C26H33FO6 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 5-[2-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-1-hydroxyethyl]-3-propan-2-yloxolan-2-one |
| SMILES | COCCCOc1cc(COCC(O)C2CC(C(C)C)C(=O)O2)ccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H33FO6/c1-17(2)22-14-25(33-26(22)29)23(28)16-31-15-18-5-10-21(19-6-8-20(27)9-7-19)24(13-18)32-12-4-11-30-3/h5-10,13,17,22-23,25,28H,4,11-12,14-16H2,1-3H3 |
| InChIKey | QWVLNWADOGMLFJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|