C25H34O6 — CID 91472974
5-[2-[[4-(2-cyclopropylethynyl)-3-(3-methoxypropoxy)phenyl]methoxy]-1-hydroxyethyl]-3-propan-2-yloxolan-2-one (PubChem CID 91472974) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 5-[2-[[4-(2-cyclopropylethynyl)-3-(3-methoxypropoxy)phenyl]methoxy]-1-hydroxyethyl]-3-propan-2-yloxolan-2-one.
| Compound Name | 5-[2-[[4-(2-cyclopropylethynyl)-3-(3-methoxypropoxy)phenyl]methoxy]-1-hydroxyethyl]-3-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 91472974 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 5-[2-[[4-(2-cyclopropylethynyl)-3-(3-methoxypropoxy)phenyl]methoxy]-1-hydroxyethyl]-3-propan-2-yloxolan-2-one |
| SMILES | COCCCOc1cc(COCC(O)C2CC(C(C)C)C(=O)O2)ccc1C#CC1CC1 |
| InChI | InChI=1S/C25H34O6/c1-17(2)21-14-24(31-25(21)27)22(26)16-29-15-19-8-10-20(9-7-18-5-6-18)23(13-19)30-12-4-11-28-3/h8,10,13,17-18,21-22,24,26H,4-6,11-12,14-16H2,1-3H3 |
| InChIKey | GNFGANZUUSWPBZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|