C25H39N3O5 — CID 90710803
5-[1-azido-3-[hydroxy-[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-4-methylpentyl]-3-propan-2-yloxolan-2-one (PubChem CID 90710803) has the molecular formula C25H39N3O5 and a molecular weight of 461.60 g/mol. Its IUPAC name is 5-[1-azido-3-[hydroxy-[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-4-methylpentyl]-3-propan-2-yloxolan-2-one.
| Compound Name | 5-[1-azido-3-[hydroxy-[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-4-methylpentyl]-3-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 90710803 |
| Molecular Formula | C25H39N3O5 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | 5-[1-azido-3-[hydroxy-[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-4-methylpentyl]-3-propan-2-yloxolan-2-one |
| SMILES | COCCCOc1cc(C(O)C(CC(N=[N+]=[N-])C2CC(C(C)C)C(=O)O2)C(C)C)ccc1C |
| InChI | InChI=1S/C25H39N3O5/c1-15(2)19(13-21(27-28-26)23-14-20(16(3)4)25(30)33-23)24(29)18-9-8-17(5)22(12-18)32-11-7-10-31-6/h8-9,12,15-16,19-21,23-24,29H,7,10-11,13-14H2,1-6H3 |
| InChIKey | LEUWBWQCCJGMCD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|