C28H42FN3O6 — CID 86634914
[(1S,4S)-4-azido-1-[4-fluoro-3-(3-methoxypropoxy)phenyl]-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylbutyl] 2-methylpropanoate (PubChem CID 86634914) has the molecular formula C28H42FN3O6 and a molecular weight of 535.66 g/mol. Its IUPAC name is [(1S,4S)-4-azido-1-[4-fluoro-3-(3-methoxypropoxy)phenyl]-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylbutyl] 2-methylpropanoate.
| Compound Name | [(1S,4S)-4-azido-1-[4-fluoro-3-(3-methoxypropoxy)phenyl]-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylbutyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 86634914 |
| Molecular Formula | C28H42FN3O6 |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | [(1S,4S)-4-azido-1-[4-fluoro-3-(3-methoxypropoxy)phenyl]-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylbutyl] 2-methylpropanoate |
| SMILES | COCCCOc1cc([C@@H](OC(=O)C(C)C)C(C[C@H](N=[N+]=[N-])[C@@H]2C[C@@H](C(C)C)C(=O)O2)C(C)C)ccc1F |
| InChI | InChI=1S/C28H42FN3O6/c1-16(2)20(14-23(31-32-30)25-15-21(17(3)4)28(34)37-25)26(38-27(33)18(5)6)19-9-10-22(29)24(13-19)36-12-8-11-35-7/h9-10,13,16-18,20-21,23,25-26H,8,11-12,14-15H2,1-7H3/t20?,21-,23-,25-,26+/m0/s1 |
| InChIKey | SPQWMSWHTQKTQR-OAVGNTSTSA-N |
| XLogP | 6.41 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|