C25H41NO4 — CID 58066022
(3S)-5-[(1S,3S)-1-amino-3-[[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-4-methylpentyl]-3-propan-2-yloxolan-2-one (PubChem CID 58066022) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is (3S)-5-[(1S,3S)-1-amino-3-[[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-4-methylpentyl]-3-propan-2-yloxolan-2-one.
| Compound Name | (3S)-5-[(1S,3S)-1-amino-3-[[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-4-methylpentyl]-3-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 58066022 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | (3S)-5-[(1S,3S)-1-amino-3-[[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-4-methylpentyl]-3-propan-2-yloxolan-2-one |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)C2C[C@@H](C(C)C)C(=O)O2)C(C)C)ccc1C |
| InChI | InChI=1S/C25H41NO4/c1-16(2)20(14-22(26)24-15-21(17(3)4)25(27)30-24)12-19-9-8-18(5)23(13-19)29-11-7-10-28-6/h8-9,13,16-17,20-22,24H,7,10-12,14-15,26H2,1-6H3/t20-,21-,22-,24?/m0/s1 |
| InChIKey | PGFVISMHDQFNJW-DNLLRGJWSA-N |
| XLogP | 4.53 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|