C22H34O5 — CID 145469376
(3S)-5-[2-[[4-ethyl-3-(3-methoxypropoxy)phenyl]methoxy]ethyl]-3-propan-2-yloxolan-2-one (PubChem CID 145469376) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (3S)-5-[2-[[4-ethyl-3-(3-methoxypropoxy)phenyl]methoxy]ethyl]-3-propan-2-yloxolan-2-one.
| Compound Name | (3S)-5-[2-[[4-ethyl-3-(3-methoxypropoxy)phenyl]methoxy]ethyl]-3-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 145469376 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (3S)-5-[2-[[4-ethyl-3-(3-methoxypropoxy)phenyl]methoxy]ethyl]-3-propan-2-yloxolan-2-one |
| SMILES | CCc1ccc(COCCC2C[C@@H](C(C)C)C(=O)O2)cc1OCCCOC |
| InChI | InChI=1S/C22H34O5/c1-5-18-8-7-17(13-21(18)26-11-6-10-24-4)15-25-12-9-19-14-20(16(2)3)22(23)27-19/h7-8,13,16,19-20H,5-6,9-12,14-15H2,1-4H3/t19?,20-/m0/s1 |
| InChIKey | BQIMPEWPIXHEGN-ANYOKISRSA-N |
| XLogP | 4.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|