C28H39FN4O5 — CID 71019490
(2S,4S,5S)-5-azido-N-ethyl-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanamide (PubChem CID 71019490) has the molecular formula C28H39FN4O5 and a molecular weight of 530.64 g/mol. Its IUPAC name is (2S,4S,5S)-5-azido-N-ethyl-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanamide.
| Compound Name | (2S,4S,5S)-5-azido-N-ethyl-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 71019490 |
| Molecular Formula | C28H39FN4O5 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | (2S,4S,5S)-5-azido-N-ethyl-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-4-hydroxy-2-propan-2-ylhexanamide |
| SMILES | CCNC(=O)[C@@H](C[C@H](O)[C@H](COCc1ccc(-c2ccc(F)cc2)c(OCCCOC)c1)N=[N+]=[N-])C(C)C |
| InChI | InChI=1S/C28H39FN4O5/c1-5-31-28(35)24(19(2)3)16-26(34)25(32-33-30)18-37-17-20-7-12-23(21-8-10-22(29)11-9-21)27(15-20)38-14-6-13-36-4/h7-12,15,19,24-26,34H,5-6,13-14,16-18H2,1-4H3,(H,31,35)/t24-,25-,26-/m0/s1 |
| InChIKey | QVLKDTHFSHEFIH-GSDHBNRESA-N |
| XLogP | 5.26 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|