C26H33F2N5O4 — CID 45277225
(2R,4S,5S)-5-azido-N-[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]-6-[(3,5-difluorophenyl)methoxy]-4-hydroxy-2-methylhexanamide (PubChem CID 45277225) has the molecular formula C26H33F2N5O4 and a molecular weight of 517.58 g/mol. Its IUPAC name is (2R,4S,5S)-5-azido-N-[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]-6-[(3,5-difluorophenyl)methoxy]-4-hydroxy-2-methylhexanamide.
| Compound Name | (2R,4S,5S)-5-azido-N-[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]-6-[(3,5-difluorophenyl)methoxy]-4-hydroxy-2-methylhexanamide |
|---|---|
| PubChem CID | 45277225 |
| Molecular Formula | C26H33F2N5O4 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | (2R,4S,5S)-5-azido-N-[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]-6-[(3,5-difluorophenyl)methoxy]-4-hydroxy-2-methylhexanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C)C[C@H](O)[C@H](COCc1cc(F)cc(F)c1)N=[N+]=[N-])C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H33F2N5O4/c1-16(2)24(26(36)30-13-18-7-5-4-6-8-18)31-25(35)17(3)9-23(34)22(32-33-29)15-37-14-19-10-20(27)12-21(28)11-19/h4-8,10-12,16-17,22-24,34H,9,13-15H2,1-3H3,(H,30,36)(H,31,35)/t17-,22+,23+,24+/m1/s1 |
| InChIKey | JXKYURZRNWJJMZ-WFBMQCHUSA-N |
| XLogP | 4.00 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|