C38H51F2N3O6 — CID 143795912
N-[2-[[(2S)-5-amino-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-2-(1-hydroxyethyl)hexanoyl]amino]-3-methylpentyl]-4-fluorobenzamide (PubChem CID 143795912) has the molecular formula C38H51F2N3O6 and a molecular weight of 683.84 g/mol. Its IUPAC name is N-[2-[[(2S)-5-amino-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-2-(1-hydroxyethyl)hexanoyl]amino]-3-methylpentyl]-4-fluorobenzamide.
| Compound Name | N-[2-[[(2S)-5-amino-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-2-(1-hydroxyethyl)hexanoyl]amino]-3-methylpentyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 143795912 |
| Molecular Formula | C38H51F2N3O6 |
| Molecular Weight | 683.84 g/mol |
| Exact Mass | 683.37 |
| IUPAC Name | N-[2-[[(2S)-5-amino-6-[[4-(4-fluorophenyl)-3-(3-methoxypropoxy)phenyl]methoxy]-2-(1-hydroxyethyl)hexanoyl]amino]-3-methylpentyl]-4-fluorobenzamide |
| SMILES | CCC(C)C(CNC(=O)c1ccc(F)cc1)NC(=O)[C@@H](CCC(N)COCc1ccc(-c2ccc(F)cc2)c(OCCCOC)c1)C(C)O |
| InChI | InChI=1S/C38H51F2N3O6/c1-5-25(2)35(22-42-37(45)29-10-14-31(40)15-11-29)43-38(46)33(26(3)44)18-16-32(41)24-48-23-27-7-17-34(28-8-12-30(39)13-9-28)36(21-27)49-20-6-19-47-4/h7-15,17,21,25-26,32-33,35,44H,5-6,16,18-20,22-24,41H2,1-4H3,(H,42,45)(H,43,46)/t25?,26?,32?,33-,35?/m0/s1 |
| InChIKey | LUSFBGDJQRKCRB-OIWYJTGMSA-N |
| XLogP | 5.63 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.84 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|