C32H52FN3O5 — CID 143795897
5-amino-N-[(3S)-1-(4-fluoroanilino)-3-methylpentan-2-yl]-6-[[3-(3-methoxypropoxy)-4-methylphenyl]methoxy]hexanamide;ethanol (PubChem CID 143795897) has the molecular formula C32H52FN3O5 and a molecular weight of 577.78 g/mol. Its IUPAC name is 5-amino-N-[(3S)-1-(4-fluoroanilino)-3-methylpentan-2-yl]-6-[[3-(3-methoxypropoxy)-4-methylphenyl]methoxy]hexanamide;ethanol.
| Compound Name | 5-amino-N-[(3S)-1-(4-fluoroanilino)-3-methylpentan-2-yl]-6-[[3-(3-methoxypropoxy)-4-methylphenyl]methoxy]hexanamide;ethanol |
|---|---|
| PubChem CID | 143795897 |
| Molecular Formula | C32H52FN3O5 |
| Molecular Weight | 577.78 g/mol |
| Exact Mass | 577.39 |
| IUPAC Name | 5-amino-N-[(3S)-1-(4-fluoroanilino)-3-methylpentan-2-yl]-6-[[3-(3-methoxypropoxy)-4-methylphenyl]methoxy]hexanamide;ethanol |
| SMILES | CCO.CC[C@H](C)C(CNc1ccc(F)cc1)NC(=O)CCCC(N)COCc1ccc(C)c(OCCCOC)c1 |
| InChI | InChI=1S/C30H46FN3O4.C2H6O/c1-5-22(2)28(19-33-27-14-12-25(31)13-15-27)34-30(35)9-6-8-26(32)21-37-20-24-11-10-23(3)29(18-24)38-17-7-16-36-4;1-2-3/h10-15,18,22,26,28,33H,5-9,16-17,19-21,32H2,1-4H3,(H,34,35);3H,2H2,1H3/t22-,26?,28?;/m0./s1 |
| InChIKey | UXYAMZBZYGPQQM-WEELSGGPSA-N |
| XLogP | 5.21 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.78 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|