C15H23ClFNO2 — CID 125466389
(2R)-1-[3-chloro-4-fluoro-5-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine (PubChem CID 125466389) has the molecular formula C15H23ClFNO2 and a molecular weight of 303.81 g/mol. Its IUPAC name is (2R)-1-[3-chloro-4-fluoro-5-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine.
| Compound Name | (2R)-1-[3-chloro-4-fluoro-5-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 125466389 |
| Molecular Formula | C15H23ClFNO2 |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (2R)-1-[3-chloro-4-fluoro-5-(3-methoxypropoxy)phenyl]-3-methylbutan-2-amine |
| SMILES | COCCCOc1cc(C[C@@H](N)C(C)C)cc(Cl)c1F |
| InChI | InChI=1S/C15H23ClFNO2/c1-10(2)13(18)8-11-7-12(16)15(17)14(9-11)20-6-4-5-19-3/h7,9-10,13H,4-6,8,18H2,1-3H3/t13-/m1/s1 |
| InChIKey | SIDLTFWURRXMHN-CYBMUJFWSA-N |
| XLogP | 3.42 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|