C16H25ClN2O3 — CID 123935421
[1-[4-chloro-3-(3-methoxypropoxy)phenyl]-3-methylbutan-2-yl]urea (PubChem CID 123935421) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is [1-[4-chloro-3-(3-methoxypropoxy)phenyl]-3-methylbutan-2-yl]urea.
| Compound Name | [1-[4-chloro-3-(3-methoxypropoxy)phenyl]-3-methylbutan-2-yl]urea |
|---|---|
| PubChem CID | 123935421 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [1-[4-chloro-3-(3-methoxypropoxy)phenyl]-3-methylbutan-2-yl]urea |
| SMILES | COCCCOc1cc(CC(NC(N)=O)C(C)C)ccc1Cl |
| InChI | InChI=1S/C16H25ClN2O3/c1-11(2)14(19-16(18)20)9-12-5-6-13(17)15(10-12)22-8-4-7-21-3/h5-6,10-11,14H,4,7-9H2,1-3H3,(H3,18,19,20) |
| InChIKey | AAHUGIAYFPDTSJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|