C14H22ClN3O3 — CID 118285373
1-amino-1-[1-[4-chloro-3-(2-hydroxyethoxy)phenyl]-3-methylbutan-2-yl]urea (PubChem CID 118285373) has the molecular formula C14H22ClN3O3 and a molecular weight of 315.80 g/mol. Its IUPAC name is 1-amino-1-[1-[4-chloro-3-(2-hydroxyethoxy)phenyl]-3-methylbutan-2-yl]urea.
| Compound Name | 1-amino-1-[1-[4-chloro-3-(2-hydroxyethoxy)phenyl]-3-methylbutan-2-yl]urea |
|---|---|
| PubChem CID | 118285373 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-amino-1-[1-[4-chloro-3-(2-hydroxyethoxy)phenyl]-3-methylbutan-2-yl]urea |
| SMILES | CC(C)C(Cc1ccc(Cl)c(OCCO)c1)N(N)C(N)=O |
| InChI | InChI=1S/C14H22ClN3O3/c1-9(2)12(18(17)14(16)20)7-10-3-4-11(15)13(8-10)21-6-5-19/h3-4,8-9,12,19H,5-7,17H2,1-2H3,(H2,16,20) |
| InChIKey | OWESEQLXSIUTOT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|