C14H23N3O3 — CID 118285034
1-amino-1-[1-(3,4-diethoxyphenyl)propan-2-yl]urea (PubChem CID 118285034) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-amino-1-[1-(3,4-diethoxyphenyl)propan-2-yl]urea.
| Compound Name | 1-amino-1-[1-(3,4-diethoxyphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 118285034 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-amino-1-[1-(3,4-diethoxyphenyl)propan-2-yl]urea |
| SMILES | CCOc1ccc(CC(C)N(N)C(N)=O)cc1OCC |
| InChI | InChI=1S/C14H23N3O3/c1-4-19-12-7-6-11(9-13(12)20-5-2)8-10(3)17(16)14(15)18/h6-7,9-10H,4-5,8,16H2,1-3H3,(H2,15,18) |
| InChIKey | WDPPVLICIAQJOM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|