C20H28F3NO4 — CID 138673063
N-[1-[3-(3-methoxypropoxy)-4-(4,4,4-trifluorobutanoyl)phenyl]-3-methylbutan-2-yl]formamide (PubChem CID 138673063) has the molecular formula C20H28F3NO4 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[1-[3-(3-methoxypropoxy)-4-(4,4,4-trifluorobutanoyl)phenyl]-3-methylbutan-2-yl]formamide.
| Compound Name | N-[1-[3-(3-methoxypropoxy)-4-(4,4,4-trifluorobutanoyl)phenyl]-3-methylbutan-2-yl]formamide |
|---|---|
| PubChem CID | 138673063 |
| Molecular Formula | C20H28F3NO4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[1-[3-(3-methoxypropoxy)-4-(4,4,4-trifluorobutanoyl)phenyl]-3-methylbutan-2-yl]formamide |
| SMILES | COCCCOc1cc(CC(NC=O)C(C)C)ccc1C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C20H28F3NO4/c1-14(2)17(24-13-25)11-15-5-6-16(18(26)7-8-20(21,22)23)19(12-15)28-10-4-9-27-3/h5-6,12-14,17H,4,7-11H2,1-3H3,(H,24,25) |
| InChIKey | PFOKYLMYYNOAPY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|